About 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine
1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine (PubChem CID 1517301) has the molecular formula C20H21N3O4S
and a molecular weight of 399.50 g/mol. Its IUPAC name is [4-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine |
| PubChem CID | 1517301 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [4-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CSC(=N2)N3CCN(CC3)C(=O)C4=CC=CO4 |
| InChI | InChI=1S/C20H21N3O4S/c1-25-14-5-6-17(26-2)15(12-14)16-13-28-20(21-16)23-9-7-22(8-10-23)19(24)18-4-3-11-27-18/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | BIQKVAWFGIFLFR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | 532 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine?
The IUPAC name of 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine (CID 1517301) is [4-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]-(furan-2-yl)methanone.
What is the SMILES notation for 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine?
The canonical SMILES for 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine is COC1=CC(=C(C=C1)OC)C2=CSC(=N2)N3CCN(CC3)C(=O)C4=CC=CO4.
What is the InChIKey of 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine?
The InChIKey is BIQKVAWFGIFLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O4S/c1-25-14-5-6-17(26-2)15(12-14)16-13-28-20(21-16)23-9-7-22(8-10-23)19(24)18-4-3-11-27-18/h3-6,11-13H,7-10H2,1-2H3.
What are the key properties of 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine?
1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine has a molecular weight of 399.50 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,5-Dimethoxyphenyl)-1,3-thiazol-2-yl]-4-(2-furoyl)piperazine is sourced from PubChem (CID 1517301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).