C12H17F5O2 — CID 151731223
1-[2-(2-methylprop-1-enoxy)ethyl]-2-(1,1,2,2,2-pentafluoroethoxy)cyclobutane (PubChem CID 151731223) has the molecular formula C12H17F5O2 and a molecular weight of 288.26 g/mol. Its IUPAC name is 1-[2-(2-methylprop-1-enoxy)ethyl]-2-(1,1,2,2,2-pentafluoroethoxy)cyclobutane.
| Compound Name | 1-[2-(2-methylprop-1-enoxy)ethyl]-2-(1,1,2,2,2-pentafluoroethoxy)cyclobutane |
|---|---|
| PubChem CID | 151731223 |
| Molecular Formula | C12H17F5O2 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[2-(2-methylprop-1-enoxy)ethyl]-2-(1,1,2,2,2-pentafluoroethoxy)cyclobutane |
| SMILES | CC(C)=COCCC1CCC1OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F5O2/c1-8(2)7-18-6-5-9-3-4-10(9)19-12(16,17)11(13,14)15/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | RKPGFRGQQBXOMP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|