About 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine
1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine (PubChem CID 151732447) has the molecular formula C12H9ClIN3
and a molecular weight of 357.58 g/mol. Its IUPAC name is 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine.
Molecular Properties
| Compound Name | 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine |
| PubChem CID | 151732447 |
| Molecular Formula | C12H9ClIN3 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine |
| SMILES | [H]/N=c1/c2c(nc3ccccn13)C=C(I)CC2Cl |
| InChI | InChI=1S/C12H9ClIN3/c13-8-5-7(14)6-9-11(8)12(15)17-4-2-1-3-10(17)16-9/h1-4,6,8,15H,5H2/b15-12- |
| InChIKey | RKVIQLFZMUWBKH-QINSGFPZSA-N |
| XLogP | 3.27 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine?
The IUPAC name of 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine (CID 151732447) is 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine.
What is the SMILES notation for 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine?
The canonical SMILES for 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine is [H]/N=c1/c2c(nc3ccccn13)C=C(I)CC2Cl.
What is the InChIKey of 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine?
The InChIKey is RKVIQLFZMUWBKH-QINSGFPZSA-N. The full InChI is InChI=1S/C12H9ClIN3/c13-8-5-7(14)6-9-11(8)12(15)17-4-2-1-3-10(17)16-9/h1-4,6,8,15H,5H2/b15-12-.
What are the key properties of 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine?
1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine has a molecular weight of 357.58 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-iodo-1,2-dihydropyrido[2,1-b]quinazolin-11-imine is sourced from PubChem (CID 151732447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).