C18H19F3N2O3 — CID 151732988
3-[5-ethoxy-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]propanoic acid (PubChem CID 151732988) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 3-[5-ethoxy-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]propanoic acid.
| Compound Name | 3-[5-ethoxy-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 151732988 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[5-ethoxy-6-[[4-(trifluoromethyl)phenyl]methylamino]-3-pyridinyl]propanoic acid |
| SMILES | CCOc1cc(CCC(=O)O)cnc1NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-2-26-15-9-13(5-8-16(24)25)11-23-17(15)22-10-12-3-6-14(7-4-12)18(19,20)21/h3-4,6-7,9,11H,2,5,8,10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | RKYGSJSHAPCPOU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |