About 3-chloropyrrol-2-one
3-chloropyrrol-2-one (PubChem CID 151737399) has the molecular formula C4H2ClNO
and a molecular weight of 115.52 g/mol. Its IUPAC name is 3-chloropyrrol-2-one.
Molecular Properties
| Compound Name | 3-chloropyrrol-2-one |
| PubChem CID | 151737399 |
| Molecular Formula | C4H2ClNO |
| Molecular Weight | 115.52 g/mol |
| Exact Mass | 114.98 |
| IUPAC Name | 3-chloropyrrol-2-one |
| SMILES | O=C1N=CC=C1Cl |
| InChI | InChI=1S/C4H2ClNO/c5-3-1-2-6-4(3)7/h1-2H |
| InChIKey | RLUVWGJSICJRDP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-chloropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropyrrol-2-one?
The IUPAC name of 3-chloropyrrol-2-one (CID 151737399) is 3-chloropyrrol-2-one.
What is the SMILES notation for 3-chloropyrrol-2-one?
The canonical SMILES for 3-chloropyrrol-2-one is O=C1N=CC=C1Cl.
What is the InChIKey of 3-chloropyrrol-2-one?
The InChIKey is RLUVWGJSICJRDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNO/c5-3-1-2-6-4(3)7/h1-2H.
What are the key properties of 3-chloropyrrol-2-one?
3-chloropyrrol-2-one has a molecular weight of 115.52 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropyrrol-2-one is sourced from PubChem (CID 151737399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).