C14H13N3O4 — CID 151739314
2-oxo-4-(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)butanoic acid (PubChem CID 151739314) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-oxo-4-(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)butanoic acid.
| Compound Name | 2-oxo-4-(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)butanoic acid |
|---|---|
| PubChem CID | 151739314 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-oxo-4-(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)butanoic acid |
| SMILES | O=C1CN2Cc3cc(CCC(=O)C(=O)O)ccc3N=C2N1 |
| InChI | InChI=1S/C14H13N3O4/c18-11(13(20)21)4-2-8-1-3-10-9(5-8)6-17-7-12(19)16-14(17)15-10/h1,3,5H,2,4,6-7H2,(H,20,21)(H,15,16,19) |
| InChIKey | RMEPRJDSRWAEAY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|