About 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione
5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione (PubChem CID 151740083) has the molecular formula C9H8O3
and a molecular weight of 164.16 g/mol. Its IUPAC name is 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione.
Molecular Properties
| Compound Name | 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione |
| PubChem CID | 151740083 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione |
| SMILES | O=C1OC(=O)C2CC3C=C1C2C3 |
| InChI | InChI=1S/C9H8O3/c10-8-6-2-4-1-5(6)7(3-4)9(11)12-8/h2,4-5,7H,1,3H2 |
| InChIKey | RMINLEQVYKBJOR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione?
The IUPAC name of 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione (CID 151740083) is 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione.
What is the SMILES notation for 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione?
The canonical SMILES for 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione is O=C1OC(=O)C2CC3C=C1C2C3.
What is the InChIKey of 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione?
The InChIKey is RMINLEQVYKBJOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3/c10-8-6-2-4-1-5(6)7(3-4)9(11)12-8/h2,4-5,7H,1,3H2.
What are the key properties of 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione?
5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione has a molecular weight of 164.16 g/mol, XLogP of 0.65, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxatricyclo[5.2.1.03,8]dec-2-ene-4,6-dione is sourced from PubChem (CID 151740083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).