C34H45F3N6O4Si — CID 151740112
tert-butyl N-[(2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate (PubChem CID 151740112) has the molecular formula C34H45F3N6O4Si and a molecular weight of 686.85 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 151740112 |
| Molecular Formula | C34H45F3N6O4Si |
| Molecular Weight | 686.85 g/mol |
| Exact Mass | 686.32 |
| IUPAC Name | tert-butyl N-[(2S)-2-[[4-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(2-trimethylsilylethoxymethyl)indol-3-yl]-5-(trifluoromethyl)pyrimidin-2-yl]amino]cyclopentyl]carbamate |
| SMILES | Cc1noc(C)c1-c1ccc2c(-c3nc(N[C@H]4CCCC4NC(=O)OC(C)(C)C)ncc3C(F)(F)F)cn(COCC[Si](C)(C)C)c2c1 |
| InChI | InChI=1S/C34H45F3N6O4Si/c1-20-29(21(2)47-42-20)22-12-13-23-24(18-43(28(23)16-22)19-45-14-15-48(6,7)8)30-25(34(35,36)37)17-38-31(41-30)39-26-10-9-11-27(26)40-32(44)46-33(3,4)5/h12-13,16-18,26-27H,9-11,14-15,19H2,1-8H3,(H,40,44)(H,38,39,41)/t26-,27?/m0/s1 |
| InChIKey | RMIQCFKRWMHPFC-QBHOUYDASA-N |
| XLogP | 8.56 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.85 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|