C26H19F3N8O — CID 151743248
3-[2-cyano-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]benzenecarboximidamide (PubChem CID 151743248) has the molecular formula C26H19F3N8O and a molecular weight of 516.49 g/mol. Its IUPAC name is 3-[2-cyano-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]benzenecarboximidamide.
| Compound Name | 3-[2-cyano-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 151743248 |
| Molecular Formula | C26H19F3N8O |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3-[2-cyano-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]ethyl]-N'-[4-(trifluoromethoxy)phenyl]benzenecarboximidamide |
| SMILES | N#CCC(c1cccc(/C(N)=N/c2ccc(OC(F)(F)F)cc2)c1)n1cc(-c2ncnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C26H19F3N8O/c27-26(28,29)38-20-6-4-19(5-7-20)36-24(31)17-3-1-2-16(12-17)22(8-10-30)37-14-18(13-35-37)23-21-9-11-32-25(21)34-15-33-23/h1-7,9,11-15,22H,8H2,(H2,31,36)(H,32,33,34) |
| InChIKey | RMYWQSUVIXBJLT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 130.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|