C11H10ClFN4O2S — CID 151747002
2-[6-chloro-2-(methylamino)pyrimidin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 151747002) has the molecular formula C11H10ClFN4O2S and a molecular weight of 316.75 g/mol. Its IUPAC name is 2-[6-chloro-2-(methylamino)pyrimidin-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-[6-chloro-2-(methylamino)pyrimidin-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 151747002 |
| Molecular Formula | C11H10ClFN4O2S |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[6-chloro-2-(methylamino)pyrimidin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | CNc1nc(Cl)cc(-c2cc(F)ccc2S(N)(=O)=O)n1 |
| InChI | InChI=1S/C11H10ClFN4O2S/c1-15-11-16-8(5-10(12)17-11)7-4-6(13)2-3-9(7)20(14,18)19/h2-5H,1H3,(H2,14,18,19)(H,15,16,17) |
| InChIKey | RNSOFWHMOHIUSZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |