About (2-methylcyclohexa-2,4-dien-1-yl)methanol
(2-methylcyclohexa-2,4-dien-1-yl)methanol (PubChem CID 15174764) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (2-methylcyclohexa-2,4-dien-1-yl)methanol.
Molecular Properties
| Compound Name | (2-methylcyclohexa-2,4-dien-1-yl)methanol |
| PubChem CID | 15174764 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (2-methylcyclohexa-2,4-dien-1-yl)methanol |
| SMILES | CC1=CC=CCC1CO |
| InChI | InChI=1S/C8H12O/c1-7-4-2-3-5-8(7)6-9/h2-4,8-9H,5-6H2,1H3 |
| InChIKey | FZVSTZWZQRUIJQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-methylcyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (2-methylcyclohexa-2,4-dien-1-yl)methanol (CID 15174764) is (2-methylcyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (2-methylcyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (2-methylcyclohexa-2,4-dien-1-yl)methanol is CC1=CC=CCC1CO.
What is the InChIKey of (2-methylcyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is FZVSTZWZQRUIJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-7-4-2-3-5-8(7)6-9/h2-4,8-9H,5-6H2,1H3.
What are the key properties of (2-methylcyclohexa-2,4-dien-1-yl)methanol?
(2-methylcyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 124.18 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 15174764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).