C7H10INO4 — CID 151753549
cis-(3S,5R)-1,3,4,5-tetrahydroxy-2-iodocyclohexane-1-carbonitrile (PubChem CID 151753549) has the molecular formula C7H10INO4 and a molecular weight of 299.06 g/mol. Its IUPAC name is cis-(3S,5R)-1,3,4,5-tetrahydroxy-2-iodocyclohexane-1-carbonitrile.
| Compound Name | cis-(3S,5R)-1,3,4,5-tetrahydroxy-2-iodocyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 151753549 |
| Molecular Formula | C7H10INO4 |
| Molecular Weight | 299.06 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | cis-(3S,5R)-1,3,4,5-tetrahydroxy-2-iodocyclohexane-1-carbonitrile |
| SMILES | N#CC1(O)C[C@@H](O)C(O)[C@H](O)C1I |
| InChI | InChI=1S/C7H10INO4/c8-6-5(12)4(11)3(10)1-7(6,13)2-9/h3-6,10-13H,1H2/t3-,4?,5+,6?,7?/m1/s1 |
| InChIKey | RPBHPPFJBDSBKN-LZUALAHLSA-N |
| XLogP | -1.47 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.06 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|