About 6-(2-bromoethyl)-1,3-benzoxazol-4-olate
6-(2-bromoethyl)-1,3-benzoxazol-4-olate (PubChem CID 151755173) has the molecular formula C9H7BrNO2-
and a molecular weight of 241.06 g/mol. Its IUPAC name is 6-(2-bromoethyl)-1,3-benzoxazol-4-olate.
Molecular Properties
| Compound Name | 6-(2-bromoethyl)-1,3-benzoxazol-4-olate |
| PubChem CID | 151755173 |
| Molecular Formula | C9H7BrNO2- |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 6-(2-bromoethyl)-1,3-benzoxazol-4-olate |
| SMILES | [O-]c1cc(CCBr)cc2ocnc12 |
| InChI | InChI=1S/C9H8BrNO2/c10-2-1-6-3-7(12)9-8(4-6)13-5-11-9/h3-5,12H,1-2H2/p-1 |
| InChIKey | ZTLHBVSWHTYODX-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 49.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-bromoethyl)-1,3-benzoxazol-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-bromoethyl)-1,3-benzoxazol-4-olate?
The IUPAC name of 6-(2-bromoethyl)-1,3-benzoxazol-4-olate (CID 151755173) is 6-(2-bromoethyl)-1,3-benzoxazol-4-olate.
What is the SMILES notation for 6-(2-bromoethyl)-1,3-benzoxazol-4-olate?
The canonical SMILES for 6-(2-bromoethyl)-1,3-benzoxazol-4-olate is [O-]c1cc(CCBr)cc2ocnc12.
What is the InChIKey of 6-(2-bromoethyl)-1,3-benzoxazol-4-olate?
The InChIKey is ZTLHBVSWHTYODX-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8BrNO2/c10-2-1-6-3-7(12)9-8(4-6)13-5-11-9/h3-5,12H,1-2H2/p-1.
What are the key properties of 6-(2-bromoethyl)-1,3-benzoxazol-4-olate?
6-(2-bromoethyl)-1,3-benzoxazol-4-olate has a molecular weight of 241.06 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-bromoethyl)-1,3-benzoxazol-4-olate is sourced from PubChem (CID 151755173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).