C9H10F5NO3 — CID 151756670
[(Z)-but-2-enyl] 2-(2,2,3,3,3-pentafluoropropanoylamino)acetate (PubChem CID 151756670) has the molecular formula C9H10F5NO3 and a molecular weight of 275.17 g/mol. Its IUPAC name is [(Z)-but-2-enyl] 2-(2,2,3,3,3-pentafluoropropanoylamino)acetate.
| Compound Name | [(Z)-but-2-enyl] 2-(2,2,3,3,3-pentafluoropropanoylamino)acetate |
|---|---|
| PubChem CID | 151756670 |
| Molecular Formula | C9H10F5NO3 |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | [(Z)-but-2-enyl] 2-(2,2,3,3,3-pentafluoropropanoylamino)acetate |
| SMILES | C/C=C\COC(=O)CNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F5NO3/c1-2-3-4-18-6(16)5-15-7(17)8(10,11)9(12,13)14/h2-3H,4-5H2,1H3,(H,15,17)/b3-2- |
| InChIKey | RPRKSNMARCCYPV-IHWYPQMZSA-N |
| XLogP | 1.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|