About 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one
6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 151759973) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one.
Molecular Properties
| Compound Name | 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one |
| PubChem CID | 151759973 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC=CC2=C1CN=c1ccccc1=N2 |
| InChI | InChI=1S/C13H10N2O/c16-13-7-3-6-10-9(13)8-14-11-4-1-2-5-12(11)15-10/h1-6H,7-8H2 |
| InChIKey | RQITUNUFNUESLB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one?
The IUPAC name of 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one (CID 151759973) is 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one.
What is the SMILES notation for 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one?
The canonical SMILES for 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one is O=C1CC=CC2=C1CN=c1ccccc1=N2.
What is the InChIKey of 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one?
The InChIKey is RQITUNUFNUESLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c16-13-7-3-6-10-9(13)8-14-11-4-1-2-5-12(11)15-10/h1-6H,7-8H2.
What are the key properties of 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one?
6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one has a molecular weight of 210.24 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydrobenzo[b][1,4]benzodiazepin-7-one is sourced from PubChem (CID 151759973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).