About 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane]
8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] (PubChem CID 15176152) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane].
Molecular Properties
| Compound Name | 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] |
| PubChem CID | 15176152 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] |
| SMILES | CN1C2CCC1CC1(CN=C(c3cn(C)c4ccccc34)O1)C2 |
| InChI | InChI=1S/C19H23N3O/c1-21-11-16(15-5-3-4-6-17(15)21)18-20-12-19(23-18)9-13-7-8-14(10-19)22(13)2/h3-6,11,13-14H,7-10,12H2,1-2H3 |
| InChIKey | XVKACSKLAHKHES-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane]?
The IUPAC name of 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] (CID 15176152) is 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane].
What is the SMILES notation for 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane]?
The canonical SMILES for 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] is CN1C2CCC1CC1(CN=C(c3cn(C)c4ccccc34)O1)C2.
What is the InChIKey of 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane]?
The InChIKey is XVKACSKLAHKHES-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-21-11-16(15-5-3-4-6-17(15)21)18-20-12-19(23-18)9-13-7-8-14(10-19)22(13)2/h3-6,11,13-14H,7-10,12H2,1-2H3.
What are the key properties of 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane]?
8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] has a molecular weight of 309.41 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-methyl-2-(1-methylindol-3-yl)spiro[4H-1,3-oxazole-5,3'-8-azabicyclo[3.2.1]octane] is sourced from PubChem (CID 15176152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).