C19H24IN3O — CID 15176163
(3S)-1-methyl-2'-(1-methylindol-3-yl)spiro[1-azoniabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] iodide (PubChem CID 15176163) has the molecular formula C19H24IN3O and a molecular weight of 437.33 g/mol. Its IUPAC name is (3S)-1-methyl-2'-(1-methylindol-3-yl)spiro[1-azoniabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] iodide.
| Compound Name | (3S)-1-methyl-2'-(1-methylindol-3-yl)spiro[1-azoniabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] iodide |
|---|---|
| PubChem CID | 15176163 |
| Molecular Formula | C19H24IN3O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | (3S)-1-methyl-2'-(1-methylindol-3-yl)spiro[1-azoniabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] iodide |
| SMILES | Cn1cc(C2=NC[C@@]3(C[N+]4(C)CCC3CC4)O2)c2ccccc21.[I-] |
| InChI | InChI=1S/C19H24N3O.HI/c1-21-11-16(15-5-3-4-6-17(15)21)18-20-12-19(23-18)13-22(2)9-7-14(19)8-10-22;/h3-6,11,14H,7-10,12-13H2,1-2H3;1H/q+1;/p-1/t14?,19-,22?;/m0./s1 |
| InChIKey | SCYCLQYCXXGMLY-SFUADWJNSA-M |
| XLogP | -0.43 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|