About 2-ethenyl-N,N-diethyl-3,4-dimethylaniline
2-ethenyl-N,N-diethyl-3,4-dimethylaniline (PubChem CID 151762255) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-ethenyl-N,N-diethyl-3,4-dimethylaniline.
Molecular Properties
| Compound Name | 2-ethenyl-N,N-diethyl-3,4-dimethylaniline |
| PubChem CID | 151762255 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-ethenyl-N,N-diethyl-3,4-dimethylaniline |
| SMILES | C=Cc1c(N(CC)CC)ccc(C)c1C |
| InChI | InChI=1S/C14H21N/c1-6-13-12(5)11(4)9-10-14(13)15(7-2)8-3/h6,9-10H,1,7-8H2,2-5H3 |
| InChIKey | RQUPSCBYASCSPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-N,N-diethyl-3,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-N,N-diethyl-3,4-dimethylaniline?
The IUPAC name of 2-ethenyl-N,N-diethyl-3,4-dimethylaniline (CID 151762255) is 2-ethenyl-N,N-diethyl-3,4-dimethylaniline.
What is the SMILES notation for 2-ethenyl-N,N-diethyl-3,4-dimethylaniline?
The canonical SMILES for 2-ethenyl-N,N-diethyl-3,4-dimethylaniline is C=Cc1c(N(CC)CC)ccc(C)c1C.
What is the InChIKey of 2-ethenyl-N,N-diethyl-3,4-dimethylaniline?
The InChIKey is RQUPSCBYASCSPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-6-13-12(5)11(4)9-10-14(13)15(7-2)8-3/h6,9-10H,1,7-8H2,2-5H3.
What are the key properties of 2-ethenyl-N,N-diethyl-3,4-dimethylaniline?
2-ethenyl-N,N-diethyl-3,4-dimethylaniline has a molecular weight of 203.33 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-N,N-diethyl-3,4-dimethylaniline is sourced from PubChem (CID 151762255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).