C14H21N — CID 151762255
2-ethenyl-N,N-diethyl-3,4-dimethylaniline (PubChem CID 151762255) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-ethenyl-N,N-diethyl-3,4-dimethylaniline.
| Compound Name | 2-ethenyl-N,N-diethyl-3,4-dimethylaniline |
|---|---|
| PubChem CID | 151762255 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-ethenyl-N,N-diethyl-3,4-dimethylaniline |
| SMILES | C=Cc1c(N(CC)CC)ccc(C)c1C |
| InChI | InChI=1S/C14H21N/c1-6-13-12(5)11(4)9-10-14(13)15(7-2)8-3/h6,9-10H,1,7-8H2,2-5H3 |
| InChIKey | RQUPSCBYASCSPR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |