C45H61Cl2N2P — CID 151765529
[3-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,4-dichloro-2-(3,3-dimethylbut-1-enylidene)cyclohexyl]-dicyclohexylphosphane (PubChem CID 151765529) has the molecular formula C45H61Cl2N2P and a molecular weight of 731.88 g/mol. Its IUPAC name is [3-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,4-dichloro-2-(3,3-dimethylbut-1-enylidene)cyclohexyl]-dicyclohexylphosphane.
| Compound Name | [3-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,4-dichloro-2-(3,3-dimethylbut-1-enylidene)cyclohexyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 151765529 |
| Molecular Formula | C45H61Cl2N2P |
| Molecular Weight | 731.88 g/mol |
| Exact Mass | 730.39 |
| IUPAC Name | [3-[1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene]-1,4-dichloro-2-(3,3-dimethylbut-1-enylidene)cyclohexyl]-dicyclohexylphosphane |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2=C2C(=C=CC(C)(C)C)C(Cl)(P(C3CCCCC3)C3CCCCC3)CCC2Cl)c(C)c1 |
| InChI | InChI=1S/C45H61Cl2N2P/c1-30-26-32(3)41(33(4)27-30)48-24-25-49(42-34(5)28-31(2)29-35(42)6)43(48)40-38(20-22-44(7,8)9)45(47,23-21-39(40)46)50(36-16-12-10-13-17-36)37-18-14-11-15-19-37/h22,24-29,36-37,39H,10-19,21,23H2,1-9H3 |
| InChIKey | RRMLUOISLMGNOF-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.88 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|