C61H52O4Si3Sn2 — CID 151768856
2,2,4,4,6,6,8,8,10,10-decakis-phenyl-1,3,5,7,2,4,6,8,10-tetraoxatrisiladistannecane (PubChem CID 151768856) has the molecular formula C61H52O4Si3Sn2 and a molecular weight of 1170.76 g/mol. Its IUPAC name is 2,2,4,4,6,6,8,8,10,10-decakis-phenyl-1,3,5,7,2,4,6,8,10-tetraoxatrisiladistannecane.
| Compound Name | 2,2,4,4,6,6,8,8,10,10-decakis-phenyl-1,3,5,7,2,4,6,8,10-tetraoxatrisiladistannecane |
|---|---|
| PubChem CID | 151768856 |
| Molecular Formula | C61H52O4Si3Sn2 |
| Molecular Weight | 1170.76 g/mol |
| Exact Mass | 1172.12 |
| IUPAC Name | 2,2,4,4,6,6,8,8,10,10-decakis-phenyl-1,3,5,7,2,4,6,8,10-tetraoxatrisiladistannecane |
| SMILES | c1ccc([Si]2(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O[Sn](c3ccccc3)(c3ccccc3)C[Sn](c3ccccc3)(c3ccccc3)O[Si](c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C36H30O4Si3.4C6H5.CH2.2Sn/c37-41(31-19-7-1-8-20-31,32-21-9-2-10-22-32)39-43(35-27-15-5-16-28-35,36-29-17-6-18-30-36)40-42(38,33-23-11-3-12-24-33)34-25-13-4-14-26-34;4*1-2-4-6-5-3-1;;;/h1-30H;4*1-5H;1H2;;/q-2;;;;;;2*+1 |
| InChIKey | RSECOUDQZUCFEC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1170.76 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|