C26H15F3N4O — CID 151769224
1-[6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acridine (PubChem CID 151769224) has the molecular formula C26H15F3N4O and a molecular weight of 456.43 g/mol. Its IUPAC name is 1-[6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acridine.
| Compound Name | 1-[6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acridine |
|---|---|
| PubChem CID | 151769224 |
| Molecular Formula | C26H15F3N4O |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[6-[4-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]acridine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc3nnc(-c4cccc5nc6ccccc6cc45)n3c2)cc1 |
| InChI | InChI=1S/C26H15F3N4O/c27-26(28,29)34-19-11-8-16(9-12-19)18-10-13-24-31-32-25(33(24)15-18)20-5-3-7-23-21(20)14-17-4-1-2-6-22(17)30-23/h1-15H |
| InChIKey | RSFVPXAGARURDO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|