C13H16N4S — CID 151774374
1,3-dimethyl-4-thiophen-2-yl-6,7,8,9-tetrahydropyrazolo[5,4-b][1,5]diazocine (PubChem CID 151774374) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 1,3-dimethyl-4-thiophen-2-yl-6,7,8,9-tetrahydropyrazolo[5,4-b][1,5]diazocine.
| Compound Name | 1,3-dimethyl-4-thiophen-2-yl-6,7,8,9-tetrahydropyrazolo[5,4-b][1,5]diazocine |
|---|---|
| PubChem CID | 151774374 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1,3-dimethyl-4-thiophen-2-yl-6,7,8,9-tetrahydropyrazolo[5,4-b][1,5]diazocine |
| SMILES | Cc1nn(C)c2c1/C(c1cccs1)=N\CCCN2 |
| InChI | InChI=1S/C13H16N4S/c1-9-11-12(10-5-3-8-18-10)14-6-4-7-15-13(11)17(2)16-9/h3,5,8,15H,4,6-7H2,1-2H3/b14-12- |
| InChIKey | RTGSVSAYLVLVLD-OWBHPGMISA-N |
| XLogP | 2.44 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |