C21H28F3NO3Si — CID 151776660
3,7-dimethyl-1-[[3-(trifluoromethyl)-3-trimethylsilyloxycyclohexyl]methyl]indole-2,6-dione (PubChem CID 151776660) has the molecular formula C21H28F3NO3Si and a molecular weight of 427.54 g/mol. Its IUPAC name is 3,7-dimethyl-1-[[3-(trifluoromethyl)-3-trimethylsilyloxycyclohexyl]methyl]indole-2,6-dione.
| Compound Name | 3,7-dimethyl-1-[[3-(trifluoromethyl)-3-trimethylsilyloxycyclohexyl]methyl]indole-2,6-dione |
|---|---|
| PubChem CID | 151776660 |
| Molecular Formula | C21H28F3NO3Si |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 3,7-dimethyl-1-[[3-(trifluoromethyl)-3-trimethylsilyloxycyclohexyl]methyl]indole-2,6-dione |
| SMILES | CC1=C2C=CC(=O)C(C)=C2N(CC2CCCC(O[Si](C)(C)C)(C(F)(F)F)C2)C1=O |
| InChI | InChI=1S/C21H28F3NO3Si/c1-13-16-8-9-17(26)14(2)18(16)25(19(13)27)12-15-7-6-10-20(11-15,21(22,23)24)28-29(3,4)5/h8-9,15H,6-7,10-12H2,1-5H3 |
| InChIKey | RTSLOXLXMPIIFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|