About (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one
(3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one (PubChem CID 15177828) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one |
| PubChem CID | 15177828 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one |
| SMILES | N[C@H]1C(=O)N(O)C[C@H]1O |
| InChI | InChI=1S/C4H8N2O3/c5-3-2(7)1-6(9)4(3)8/h2-3,7,9H,1,5H2/t2-,3-/m1/s1 |
| InChIKey | VGRRTBHWJUGFGT-PWNYCUMCSA-N |
| XLogP | -2.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one?
The IUPAC name of (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one (CID 15177828) is (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one.
What is the SMILES notation for (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one?
The canonical SMILES for (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one is N[C@H]1C(=O)N(O)C[C@H]1O.
What is the InChIKey of (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one?
The InChIKey is VGRRTBHWJUGFGT-PWNYCUMCSA-N. The full InChI is InChI=1S/C4H8N2O3/c5-3-2(7)1-6(9)4(3)8/h2-3,7,9H,1,5H2/t2-,3-/m1/s1.
What are the key properties of (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one?
(3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one has a molecular weight of 132.12 g/mol, XLogP of -2.09, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3-amino-1,4-dihydroxypyrrolidin-2-one is sourced from PubChem (CID 15177828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).