C20H27NO — CID 15177917
(1R,9R,10R)-16-(3-methylbut-2-enyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol (PubChem CID 15177917) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (1R,9R,10R)-16-(3-methylbut-2-enyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10R)-16-(3-methylbut-2-enyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 15177917 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (1R,9R,10R)-16-(3-methylbut-2-enyl)-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
| SMILES | CC(C)=CCN1CC[C@]23CCC[C@H]2[C@H]1Cc1ccc(O)cc13 |
| InChI | InChI=1S/C20H27NO/c1-14(2)7-10-21-11-9-20-8-3-4-17(20)19(21)12-15-5-6-16(22)13-18(15)20/h5-7,13,17,19,22H,3-4,8-12H2,1-2H3/t17-,19+,20+/m0/s1 |
| InChIKey | WFAJRFMBAXXGSR-DFQSSKMNSA-N |
| XLogP | 4.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|