C15F11NO — CID 15178365
2,3,5,6-tetrafluoro-4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypyridine (PubChem CID 15178365) has the molecular formula C15F11NO and a molecular weight of 419.15 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypyridine |
|---|---|
| PubChem CID | 15178365 |
| Molecular Formula | C15F11NO |
| Molecular Weight | 419.15 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)oxypyridine |
| SMILES | Fc1nc(F)c(F)c(Oc2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c1F |
| InChI | InChI=1S/C15F11NO/c16-3-1-2(5(18)7(20)6(3)19)12(9(22)8(21)4(1)17)28-13-10(23)14(25)27-15(26)11(13)24 |
| InChIKey | IYFVYINJWOBULY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.15 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|