C11H11N3O3S — CID 15178554
3-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide (PubChem CID 15178554) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 3-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide.
| Compound Name | 3-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 15178554 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide |
| SMILES | COc1cccc(C(=O)Nc2nc(=O)n(C)s2)c1 |
| InChI | InChI=1S/C11H11N3O3S/c1-14-11(16)13-10(18-14)12-9(15)7-4-3-5-8(6-7)17-2/h3-6H,1-2H3,(H,12,13,15,16) |
| InChIKey | VRTHPHIHQDZPKE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |