C12H15F6N — CID 151786518
2,2,6-trimethyl-3,4-bis(2,2,2-trifluoroethyl)-1H-pyridine (PubChem CID 151786518) has the molecular formula C12H15F6N and a molecular weight of 287.25 g/mol. Its IUPAC name is 2,2,6-trimethyl-3,4-bis(2,2,2-trifluoroethyl)-1H-pyridine.
| Compound Name | 2,2,6-trimethyl-3,4-bis(2,2,2-trifluoroethyl)-1H-pyridine |
|---|---|
| PubChem CID | 151786518 |
| Molecular Formula | C12H15F6N |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2,2,6-trimethyl-3,4-bis(2,2,2-trifluoroethyl)-1H-pyridine |
| SMILES | CC1=CC(CC(F)(F)F)=C(CC(F)(F)F)C(C)(C)N1 |
| InChI | InChI=1S/C12H15F6N/c1-7-4-8(5-11(13,14)15)9(6-12(16,17)18)10(2,3)19-7/h4,19H,5-6H2,1-3H3 |
| InChIKey | RVSIYYNULVSROE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |