About (2S)-2-azido-3,3-dimethylbutanamide
(2S)-2-azido-3,3-dimethylbutanamide (PubChem CID 151787288) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is (2S)-2-azido-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-azido-3,3-dimethylbutanamide |
| PubChem CID | 151787288 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (2S)-2-azido-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)[C@H](N=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C6H12N4O/c1-6(2,3)4(5(7)11)9-10-8/h4H,1-3H3,(H2,7,11)/t4-/m1/s1 |
| InChIKey | RVWNVMJOUSUQKK-SCSAIBSYSA-N |
| XLogP | 1.20 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-azido-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-azido-3,3-dimethylbutanamide?
The IUPAC name of (2S)-2-azido-3,3-dimethylbutanamide (CID 151787288) is (2S)-2-azido-3,3-dimethylbutanamide.
What is the SMILES notation for (2S)-2-azido-3,3-dimethylbutanamide?
The canonical SMILES for (2S)-2-azido-3,3-dimethylbutanamide is CC(C)(C)[C@H](N=[N+]=[N-])C(N)=O.
What is the InChIKey of (2S)-2-azido-3,3-dimethylbutanamide?
The InChIKey is RVWNVMJOUSUQKK-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-6(2,3)4(5(7)11)9-10-8/h4H,1-3H3,(H2,7,11)/t4-/m1/s1.
What are the key properties of (2S)-2-azido-3,3-dimethylbutanamide?
(2S)-2-azido-3,3-dimethylbutanamide has a molecular weight of 156.19 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-azido-3,3-dimethylbutanamide is sourced from PubChem (CID 151787288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).