C22H26N4O3 — CID 151788740
2-[[(2S)-2-(1-aminoethyl)-3-phenyl-2H-quinazolin-5-yl]oxy]-1-morpholin-4-ylethanone (PubChem CID 151788740) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[[(2S)-2-(1-aminoethyl)-3-phenyl-2H-quinazolin-5-yl]oxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[[(2S)-2-(1-aminoethyl)-3-phenyl-2H-quinazolin-5-yl]oxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 151788740 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[[(2S)-2-(1-aminoethyl)-3-phenyl-2H-quinazolin-5-yl]oxy]-1-morpholin-4-ylethanone |
| SMILES | CC(N)[C@@H]1N=c2cccc(OCC(=O)N3CCOCC3)c2=CN1c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3/c1-16(23)22-24-19-8-5-9-20(29-15-21(27)25-10-12-28-13-11-25)18(19)14-26(22)17-6-3-2-4-7-17/h2-9,14,16,22H,10-13,15,23H2,1H3/t16?,22-/m1/s1 |
| InChIKey | RWEBFHAESGBETF-VXNXSFHZSA-N |
| XLogP | 0.48 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |