C42H45F5N6O — CID 151794908
N-[8-[2-(2,2-difluoroethoxy)-5-(10,10,10-trifluorodecyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(1H-indol-2-yl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine (PubChem CID 151794908) has the molecular formula C42H45F5N6O and a molecular weight of 744.85 g/mol. Its IUPAC name is N-[8-[2-(2,2-difluoroethoxy)-5-(10,10,10-trifluorodecyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(1H-indol-2-yl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine.
| Compound Name | N-[8-[2-(2,2-difluoroethoxy)-5-(10,10,10-trifluorodecyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(1H-indol-2-yl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
|---|---|
| PubChem CID | 151794908 |
| Molecular Formula | C42H45F5N6O |
| Molecular Weight | 744.85 g/mol |
| Exact Mass | 744.36 |
| IUPAC Name | N-[8-[2-(2,2-difluoroethoxy)-5-(10,10,10-trifluorodecyl)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-3-(1H-indol-2-yl)-1,2,4,5-tetrahydro-3-benzazepin-7-amine |
| SMILES | FC(F)COc1ccc(CCCCCCCCCC(F)(F)F)cc1-c1cccn2nc(Nc3ccc4c(c3)CCN(c3cc5ccccc5[nH]3)CC4)nc12 |
| InChI | InChI=1S/C42H45F5N6O/c43-38(44)28-54-37-18-15-29(11-6-4-2-1-3-5-9-21-42(45,46)47)25-35(37)34-13-10-22-53-40(34)50-41(51-53)48-33-17-16-30-19-23-52(24-20-31(30)26-33)39-27-32-12-7-8-14-36(32)49-39/h7-8,10,12-18,22,25-27,38,49H,1-6,9,11,19-21,23-24,28H2,(H,48,51) |
| InChIKey | RXJWEPTUVVFUSS-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.85 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|