About 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide
1-(furan-2-yl)-1,2,4-triazole-3-carboxamide (PubChem CID 151796248) has the molecular formula C7H6N4O2
and a molecular weight of 178.15 g/mol. Its IUPAC name is 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide |
| PubChem CID | 151796248 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(-c2ccco2)n1 |
| InChI | InChI=1S/C7H6N4O2/c8-6(12)7-9-4-11(10-7)5-2-1-3-13-5/h1-4H,(H2,8,12) |
| InChIKey | RXQPDAOZITUYLM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide?
The IUPAC name of 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide (CID 151796248) is 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide.
What is the SMILES notation for 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide?
The canonical SMILES for 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide is NC(=O)c1ncn(-c2ccco2)n1.
What is the InChIKey of 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide?
The InChIKey is RXQPDAOZITUYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O2/c8-6(12)7-9-4-11(10-7)5-2-1-3-13-5/h1-4H,(H2,8,12).
What are the key properties of 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide?
1-(furan-2-yl)-1,2,4-triazole-3-carboxamide has a molecular weight of 178.15 g/mol, XLogP of -0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-1,2,4-triazole-3-carboxamide is sourced from PubChem (CID 151796248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).