C21H25F3N2O3 — CID 151797621
2-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methylamino]phenyl]methyl]butanoic acid (PubChem CID 151797621) has the molecular formula C21H25F3N2O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methylamino]phenyl]methyl]butanoic acid.
| Compound Name | 2-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methylamino]phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 151797621 |
| Molecular Formula | C21H25F3N2O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[4-methoxy-3-[[[4-(trifluoromethyl)phenyl]methylamino]methylamino]phenyl]methyl]butanoic acid |
| SMILES | CCC(Cc1ccc(OC)c(NCNCc2ccc(C(F)(F)F)cc2)c1)C(=O)O |
| InChI | InChI=1S/C21H25F3N2O3/c1-3-16(20(27)28)10-15-6-9-19(29-2)18(11-15)26-13-25-12-14-4-7-17(8-5-14)21(22,23)24/h4-9,11,16,25-26H,3,10,12-13H2,1-2H3,(H,27,28) |
| InChIKey | RXXVQMVIWJWSGS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|