C11H15NO — CID 15179871
5-methyl-1,3,4,6-tetrahydro-2,5-benzoxazocine (PubChem CID 15179871) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 5-methyl-1,3,4,6-tetrahydro-2,5-benzoxazocine.
| Compound Name | 5-methyl-1,3,4,6-tetrahydro-2,5-benzoxazocine |
|---|---|
| PubChem CID | 15179871 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 5-methyl-1,3,4,6-tetrahydro-2,5-benzoxazocine |
| SMILES | CN1CCOCc2ccccc2C1 |
| InChI | InChI=1S/C11H15NO/c1-12-6-7-13-9-11-5-3-2-4-10(11)8-12/h2-5H,6-9H2,1H3 |
| InChIKey | WLALZKCWUQVAKH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |