C13H23NO3S — CID 15179920
1-[2-(1-hydroxy-2,2-dimethylpropyl)-3-oxido-1,3-thiazol-3-ium-5-yl]-2,2-dimethylpropan-1-ol (PubChem CID 15179920) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-[2-(1-hydroxy-2,2-dimethylpropyl)-3-oxido-1,3-thiazol-3-ium-5-yl]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[2-(1-hydroxy-2,2-dimethylpropyl)-3-oxido-1,3-thiazol-3-ium-5-yl]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 15179920 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-[2-(1-hydroxy-2,2-dimethylpropyl)-3-oxido-1,3-thiazol-3-ium-5-yl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(C)C(O)c1c[n+]([O-])c(C(O)C(C)(C)C)s1 |
| InChI | InChI=1S/C13H23NO3S/c1-12(2,3)9(15)8-7-14(17)11(18-8)10(16)13(4,5)6/h7,9-10,15-16H,1-6H3 |
| InChIKey | DXIWSHJXQXCDSE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|