About pyrrolo[1,2-c]pyrimidine-1-carbonitrile
pyrrolo[1,2-c]pyrimidine-1-carbonitrile (PubChem CID 151799232) has the molecular formula C8H5N3
and a molecular weight of 143.15 g/mol. Its IUPAC name is pyrrolo[1,2-c]pyrimidine-1-carbonitrile.
Molecular Properties
| Compound Name | pyrrolo[1,2-c]pyrimidine-1-carbonitrile |
| PubChem CID | 151799232 |
| Molecular Formula | C8H5N3 |
| Molecular Weight | 143.15 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | pyrrolo[1,2-c]pyrimidine-1-carbonitrile |
| SMILES | N#Cc1nccc2cccn12 |
| InChI | InChI=1S/C8H5N3/c9-6-8-10-4-3-7-2-1-5-11(7)8/h1-5H |
| InChIKey | RYGIXKQRGZTMJH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[1,2-c]pyrimidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-c]pyrimidine-1-carbonitrile?
The IUPAC name of pyrrolo[1,2-c]pyrimidine-1-carbonitrile (CID 151799232) is pyrrolo[1,2-c]pyrimidine-1-carbonitrile.
What is the SMILES notation for pyrrolo[1,2-c]pyrimidine-1-carbonitrile?
The canonical SMILES for pyrrolo[1,2-c]pyrimidine-1-carbonitrile is N#Cc1nccc2cccn12.
What is the InChIKey of pyrrolo[1,2-c]pyrimidine-1-carbonitrile?
The InChIKey is RYGIXKQRGZTMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3/c9-6-8-10-4-3-7-2-1-5-11(7)8/h1-5H.
What are the key properties of pyrrolo[1,2-c]pyrimidine-1-carbonitrile?
pyrrolo[1,2-c]pyrimidine-1-carbonitrile has a molecular weight of 143.15 g/mol, XLogP of 1.21, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-c]pyrimidine-1-carbonitrile is sourced from PubChem (CID 151799232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).