C21H24ClN7O2S2 — CID 151799396
4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-N-(1,3-thiazol-2-yl)indazole-1-sulfonamide (PubChem CID 151799396) has the molecular formula C21H24ClN7O2S2 and a molecular weight of 506.06 g/mol. Its IUPAC name is 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-N-(1,3-thiazol-2-yl)indazole-1-sulfonamide.
| Compound Name | 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-N-(1,3-thiazol-2-yl)indazole-1-sulfonamide |
|---|---|
| PubChem CID | 151799396 |
| Molecular Formula | C21H24ClN7O2S2 |
| Molecular Weight | 506.06 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 4-[[4-chloro-2-[2-(ethylamino)ethylamino]phenyl]methylamino]-N-(1,3-thiazol-2-yl)indazole-1-sulfonamide |
| SMILES | CCNCCNc1cc(Cl)ccc1CNc1cccc2c1cnn2S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C21H24ClN7O2S2/c1-2-23-8-9-24-19-12-16(22)7-6-15(19)13-26-18-4-3-5-20-17(18)14-27-29(20)33(30,31)28-21-25-10-11-32-21/h3-7,10-12,14,23-24,26H,2,8-9,13H2,1H3,(H,25,28) |
| InChIKey | RYHCRRZGLGVPEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|