About 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole
1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole (PubChem CID 151800929) has the molecular formula C10H9F2N
and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole.
Molecular Properties
| Compound Name | 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole |
| PubChem CID | 151800929 |
| Molecular Formula | C10H9F2N |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole |
| SMILES | FC1=CC=CC(F)C1n1cccc1 |
| InChI | InChI=1S/C10H9F2N/c11-8-4-3-5-9(12)10(8)13-6-1-2-7-13/h1-8,10H |
| InChIKey | QZKKFZSDPNJSEJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole?
The IUPAC name of 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole (CID 151800929) is 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole.
What is the SMILES notation for 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole?
The canonical SMILES for 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole is FC1=CC=CC(F)C1n1cccc1.
What is the InChIKey of 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole?
The InChIKey is QZKKFZSDPNJSEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N/c11-8-4-3-5-9(12)10(8)13-6-1-2-7-13/h1-8,10H.
What are the key properties of 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole?
1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole has a molecular weight of 181.19 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-difluorocyclohexa-2,4-dien-1-yl)pyrrole is sourced from PubChem (CID 151800929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).