C19H44Si4 — CID 15180195
triethyl-[1,4,4-tris(trimethylsilyl)buta-2,3-dien-2-yl]silane (PubChem CID 15180195) has the molecular formula C19H44Si4 and a molecular weight of 384.91 g/mol. Its IUPAC name is triethyl-[1,4,4-tris(trimethylsilyl)buta-2,3-dien-2-yl]silane.
| Compound Name | triethyl-[1,4,4-tris(trimethylsilyl)buta-2,3-dien-2-yl]silane |
|---|---|
| PubChem CID | 15180195 |
| Molecular Formula | C19H44Si4 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | triethyl-[1,4,4-tris(trimethylsilyl)buta-2,3-dien-2-yl]silane |
| SMILES | CC[Si](CC)(CC)C(=C=C([Si](C)(C)C)[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C19H44Si4/c1-13-23(14-2,15-3)18(17-20(4,5)6)16-19(21(7,8)9)22(10,11)12/h13-15,17H2,1-12H3 |
| InChIKey | ZCYMZSWAOJCUHD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|