C22H42O4 — CID 151802896
(2R)-2-(6,6-diethoxypentadec-4-enoxymethyl)oxirane (PubChem CID 151802896) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is (2R)-2-(6,6-diethoxypentadec-4-enoxymethyl)oxirane.
| Compound Name | (2R)-2-(6,6-diethoxypentadec-4-enoxymethyl)oxirane |
|---|---|
| PubChem CID | 151802896 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | (2R)-2-(6,6-diethoxypentadec-4-enoxymethyl)oxirane |
| SMILES | CCCCCCCCCC(C=CCCCOC[C@H]1CO1)(OCC)OCC |
| InChI | InChI=1S/C22H42O4/c1-4-7-8-9-10-11-13-16-22(25-5-2,26-6-3)17-14-12-15-18-23-19-21-20-24-21/h14,17,21H,4-13,15-16,18-20H2,1-3H3/t21-/m0/s1 |
| InChIKey | RYZKWGQUMRXDBS-NRFANRHFSA-N |
| XLogP | 5.65 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|