C15H19BFNO4S — CID 151803032
6-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 151803032) has the molecular formula C15H19BFNO4S and a molecular weight of 339.20 g/mol. Its IUPAC name is 6-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 151803032 |
| Molecular Formula | C15H19BFNO4S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-fluoro-1-methylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | CC1(C)OB(c2cc(F)cc3c2ccn3S(C)(=O)=O)OC1(C)C |
| InChI | InChI=1S/C15H19BFNO4S/c1-14(2)15(3,4)22-16(21-14)12-8-10(17)9-13-11(12)6-7-18(13)23(5,19)20/h6-9H,1-5H3 |
| InChIKey | RZADCELTGJDOTF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|