C26H31N7O — CID 151805132
5-[(2R,6S)-2-methyl-6-[[3-[(7S)-7-methyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]azetidin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile (PubChem CID 151805132) has the molecular formula C26H31N7O and a molecular weight of 457.58 g/mol. Its IUPAC name is 5-[(2R,6S)-2-methyl-6-[[3-[(7S)-7-methyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]azetidin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(2R,6S)-2-methyl-6-[[3-[(7S)-7-methyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]azetidin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 151805132 |
| Molecular Formula | C26H31N7O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 5-[(2R,6S)-2-methyl-6-[[3-[(7S)-7-methyl-4,5,6,7-tetrahydropyrazolo[5,4-c]pyridin-1-yl]azetidin-1-yl]methyl]morpholin-4-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H](CN2CC(n3ncc4c3[C@H](C)NCC4)C2)O1 |
| InChI | InChI=1S/C26H31N7O/c1-17-12-32(24-6-5-19(10-27)25-23(24)4-3-8-29-25)16-22(34-17)15-31-13-21(14-31)33-26-18(2)28-9-7-20(26)11-30-33/h3-6,8,11,17-18,21-22,28H,7,9,12-16H2,1-2H3/t17-,18+,22+/m1/s1 |
| InChIKey | RZLGDAZQCBGDKC-FGSXEWAUSA-N |
| XLogP | 2.66 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |