About 2,2-dinitroethanamine
2,2-dinitroethanamine (PubChem CID 15180700) has the molecular formula C2H5N3O4
and a molecular weight of 135.08 g/mol. Its IUPAC name is 2,2-dinitroethanamine.
Molecular Properties
| Compound Name | 2,2-dinitroethanamine |
| PubChem CID | 15180700 |
| Molecular Formula | C2H5N3O4 |
| Molecular Weight | 135.08 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 2,2-dinitroethanamine |
| SMILES | NCC([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C2H5N3O4/c3-1-2(4(6)7)5(8)9/h2H,1,3H2 |
| InChIKey | VBOZRIVJUWIREO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.08 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dinitroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dinitroethanamine?
The IUPAC name of 2,2-dinitroethanamine (CID 15180700) is 2,2-dinitroethanamine.
What is the SMILES notation for 2,2-dinitroethanamine?
The canonical SMILES for 2,2-dinitroethanamine is NCC([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2,2-dinitroethanamine?
The InChIKey is VBOZRIVJUWIREO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N3O4/c3-1-2(4(6)7)5(8)9/h2H,1,3H2.
What are the key properties of 2,2-dinitroethanamine?
2,2-dinitroethanamine has a molecular weight of 135.08 g/mol, XLogP of -1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dinitroethanamine is sourced from PubChem (CID 15180700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).