C20H15Cl2NO2 — CID 15180748
5,6-bis(4-chlorophenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (PubChem CID 15180748) has the molecular formula C20H15Cl2NO2 and a molecular weight of 372.25 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid.
| Compound Name | 5,6-bis(4-chlorophenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 15180748 |
| Molecular Formula | C20H15Cl2NO2 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| SMILES | O=C(O)C1CCn2c1cc(-c1ccc(Cl)cc1)c2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15Cl2NO2/c21-14-5-1-12(2-6-14)17-11-18-16(20(24)25)9-10-23(18)19(17)13-3-7-15(22)8-4-13/h1-8,11,16H,9-10H2,(H,24,25) |
| InChIKey | AXQDVHZHDJYAQW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |