C19H16F6O — CID 15180803
2,3,6,7-tetramethyl-9,9-bis(trifluoromethyl)xanthene (PubChem CID 15180803) has the molecular formula C19H16F6O and a molecular weight of 374.32 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-9,9-bis(trifluoromethyl)xanthene.
| Compound Name | 2,3,6,7-tetramethyl-9,9-bis(trifluoromethyl)xanthene |
|---|---|
| PubChem CID | 15180803 |
| Molecular Formula | C19H16F6O |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2,3,6,7-tetramethyl-9,9-bis(trifluoromethyl)xanthene |
| SMILES | Cc1cc2c(cc1C)C(C(F)(F)F)(C(F)(F)F)c1cc(C)c(C)cc1O2 |
| InChI | InChI=1S/C19H16F6O/c1-9-5-13-15(7-11(9)3)26-16-8-12(4)10(2)6-14(16)17(13,18(20,21)22)19(23,24)25/h5-8H,1-4H3 |
| InChIKey | MBZVPENZVICHRL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |