C20H16F8O — CID 15180817
2,3,6,7-tetramethyl-9-(1,1,2,2,2-pentafluoroethyl)-9-(trifluoromethyl)xanthene (PubChem CID 15180817) has the molecular formula C20H16F8O and a molecular weight of 424.33 g/mol. Its IUPAC name is 2,3,6,7-tetramethyl-9-(1,1,2,2,2-pentafluoroethyl)-9-(trifluoromethyl)xanthene.
| Compound Name | 2,3,6,7-tetramethyl-9-(1,1,2,2,2-pentafluoroethyl)-9-(trifluoromethyl)xanthene |
|---|---|
| PubChem CID | 15180817 |
| Molecular Formula | C20H16F8O |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2,3,6,7-tetramethyl-9-(1,1,2,2,2-pentafluoroethyl)-9-(trifluoromethyl)xanthene |
| SMILES | Cc1cc2c(cc1C)C(C(F)(F)F)(C(F)(F)C(F)(F)F)c1cc(C)c(C)cc1O2 |
| InChI | InChI=1S/C20H16F8O/c1-9-5-13-15(7-11(9)3)29-16-8-12(4)10(2)6-14(16)17(13,19(23,24)25)18(21,22)20(26,27)28/h5-8H,1-4H3 |
| InChIKey | INCJTAUEPNZSDG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|