About 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one
1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one (PubChem CID 151809049) has the molecular formula C21H16F2N4O5
and a molecular weight of 442.38 g/mol. Its IUPAC name is 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one.
Molecular Properties
| Compound Name | 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one |
| PubChem CID | 151809049 |
| Molecular Formula | C21H16F2N4O5 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one |
| SMILES | O=C(C(CF)c1c[nH]c2cc([N+](=O)[O-])ccc12)C(CF)c1c[nH]c2cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C21H16F2N4O5/c22-7-15(17-9-24-19-5-11(26(29)30)1-3-13(17)19)21(28)16(8-23)18-10-25-20-6-12(27(31)32)2-4-14(18)20/h1-6,9-10,15-16,24-25H,7-8H2 |
| InChIKey | SAFKDJRXQUCBIZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one?
The IUPAC name of 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one (CID 151809049) is 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one.
What is the SMILES notation for 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one?
The canonical SMILES for 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one is O=C(C(CF)c1c[nH]c2cc([N+](=O)[O-])ccc12)C(CF)c1c[nH]c2cc([N+](=O)[O-])ccc12.
What is the InChIKey of 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one?
The InChIKey is SAFKDJRXQUCBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N4O5/c22-7-15(17-9-24-19-5-11(26(29)30)1-3-13(17)19)21(28)16(8-23)18-10-25-20-6-12(27(31)32)2-4-14(18)20/h1-6,9-10,15-16,24-25H,7-8H2.
What are the key properties of 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one?
1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one has a molecular weight of 442.38 g/mol, XLogP of 4.84, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-2,4-bis(6-nitro-1H-indol-3-yl)pentan-3-one is sourced from PubChem (CID 151809049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).