C20H23F3N4O5 — CID 151809863
3-amino-N-[(3S,4R)-3-hydroxyoxan-4-yl]-6-[2-(trideuteriomethyl)-5-[(2S)-1,1,1-trifluoro-2,3-dihydroxypropan-2-yl]phenyl]pyrazine-2-carboxamide (PubChem CID 151809863) has the molecular formula C20H23F3N4O5 and a molecular weight of 459.44 g/mol. Its IUPAC name is 3-amino-N-[(3S,4R)-3-hydroxyoxan-4-yl]-6-[2-(trideuteriomethyl)-5-[(2S)-1,1,1-trifluoro-2,3-dihydroxypropan-2-yl]phenyl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(3S,4R)-3-hydroxyoxan-4-yl]-6-[2-(trideuteriomethyl)-5-[(2S)-1,1,1-trifluoro-2,3-dihydroxypropan-2-yl]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 151809863 |
| Molecular Formula | C20H23F3N4O5 |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-amino-N-[(3S,4R)-3-hydroxyoxan-4-yl]-6-[2-(trideuteriomethyl)-5-[(2S)-1,1,1-trifluoro-2,3-dihydroxypropan-2-yl]phenyl]pyrazine-2-carboxamide |
| SMILES | [2H]C([2H])([2H])c1ccc([C@](O)(CO)C(F)(F)F)cc1-c1cnc(N)c(C(=O)N[C@@H]2CCOC[C@H]2O)n1 |
| InChI | InChI=1S/C20H23F3N4O5/c1-10-2-3-11(19(31,9-28)20(21,22)23)6-12(10)14-7-25-17(24)16(26-14)18(30)27-13-4-5-32-8-15(13)29/h2-3,6-7,13,15,28-29,31H,4-5,8-9H2,1H3,(H2,24,25)(H,27,30)/t13-,15-,19-/m1/s1/i1D3 |
| InChIKey | SAJNZIWGWYOPPY-ORMDSGPVSA-N |
| XLogP | 0.66 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |