C29H30N4O — CID 151810411
1-[3-(but-1-ynylamino)cyclohexyl]-3-(4-phenoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine (PubChem CID 151810411) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-[3-(but-1-ynylamino)cyclohexyl]-3-(4-phenoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine.
| Compound Name | 1-[3-(but-1-ynylamino)cyclohexyl]-3-(4-phenoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 151810411 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[3-(but-1-ynylamino)cyclohexyl]-3-(4-phenoxyphenyl)pyrrolo[3,2-c]pyridin-4-amine |
| SMILES | CCC#CNC1CCCC(n2cc(-c3ccc(Oc4ccccc4)cc3)c3c(N)nccc32)C1 |
| InChI | InChI=1S/C29H30N4O/c1-2-3-17-31-22-8-7-9-23(19-22)33-20-26(28-27(33)16-18-32-29(28)30)21-12-14-25(15-13-21)34-24-10-5-4-6-11-24/h4-6,10-16,18,20,22-23,31H,2,7-9,19H2,1H3,(H2,30,32) |
| InChIKey | SAMNLRJWEWMFPZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|