C12H20NiO4S8-4 — CID 15181143
bis((Z)-1,2-bis(2-hydroxyethylsulfanyl)ethene-1,2-dithiolate);nickel (PubChem CID 15181143) has the molecular formula C12H20NiO4S8-4 and a molecular weight of 543.52 g/mol. Its IUPAC name is bis((Z)-1,2-bis(2-hydroxyethylsulfanyl)ethene-1,2-dithiolate);nickel.
| Compound Name | bis((Z)-1,2-bis(2-hydroxyethylsulfanyl)ethene-1,2-dithiolate);nickel |
|---|---|
| PubChem CID | 15181143 |
| Molecular Formula | C12H20NiO4S8-4 |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 541.85 |
| IUPAC Name | bis((Z)-1,2-bis(2-hydroxyethylsulfanyl)ethene-1,2-dithiolate);nickel |
| SMILES | OCCS/C([S-])=C(/[S-])SCCO.OCCS/C([S-])=C(/[S-])SCCO.[Ni] |
| InChI | InChI=1S/2C6H12O2S4.Ni/c2*7-1-3-11-5(9)6(10)12-4-2-8;/h2*7-10H,1-4H2;/p-4/b2*6-5-; |
| InChIKey | VVGZEAGXTLBYJR-VKRZFSCASA-J |
| XLogP | 1.31 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|